About 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine
2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine (PubChem CID 158706729) has the molecular formula C12H11ClI2N2O
and a molecular weight of 488.49 g/mol. Its IUPAC name is 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine.
Molecular Properties
| Compound Name | 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine |
| PubChem CID | 158706729 |
| Molecular Formula | C12H11ClI2N2O |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 487.86 |
| IUPAC Name | 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine |
| SMILES | CCOc1cc(I)ccn1.Clc1cc(I)ccn1 |
| InChI | InChI=1S/C7H8INO.C5H3ClIN/c1-2-10-7-5-6(8)3-4-9-7;6-5-3-4(7)1-2-8-5/h3-5H,2H2,1H3;1-3H |
| InChIKey | IIEWZHAZBLYSLY-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine?
The IUPAC name of 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine (CID 158706729) is 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine.
What is the SMILES notation for 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine?
The canonical SMILES for 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine is CCOc1cc(I)ccn1.Clc1cc(I)ccn1.
What is the InChIKey of 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine?
The InChIKey is IIEWZHAZBLYSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8INO.C5H3ClIN/c1-2-10-7-5-6(8)3-4-9-7;6-5-3-4(7)1-2-8-5/h3-5H,2H2,1H3;1-3H.
What are the key properties of 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine?
2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine has a molecular weight of 488.49 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-iodopyridine;2-ethoxy-4-iodopyridine is sourced from PubChem (CID 158706729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).