C32H34N4O9 — CID 158711619
4-hydroxy-2-methoxybenzaldehyde;N-[(4-hydroxy-2-methoxyphenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide;2-(3-hydroxyphenyl)acetohydrazide (PubChem CID 158711619) has the molecular formula C32H34N4O9 and a molecular weight of 618.64 g/mol. Its IUPAC name is 4-hydroxy-2-methoxybenzaldehyde;N-[(4-hydroxy-2-methoxyphenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide;2-(3-hydroxyphenyl)acetohydrazide.
| Compound Name | 4-hydroxy-2-methoxybenzaldehyde;N-[(4-hydroxy-2-methoxyphenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide;2-(3-hydroxyphenyl)acetohydrazide |
|---|---|
| PubChem CID | 158711619 |
| Molecular Formula | C32H34N4O9 |
| Molecular Weight | 618.64 g/mol |
| Exact Mass | 618.23 |
| IUPAC Name | 4-hydroxy-2-methoxybenzaldehyde;N-[(4-hydroxy-2-methoxyphenyl)methylideneamino]-2-(3-hydroxyphenyl)acetamide;2-(3-hydroxyphenyl)acetohydrazide |
| SMILES | COc1cc(O)ccc1C=NNC(=O)Cc1cccc(O)c1.COc1cc(O)ccc1C=O.NNC(=O)Cc1cccc(O)c1 |
| InChI | InChI=1S/C16H16N2O4.C8H10N2O2.C8H8O3/c1-22-15-9-14(20)6-5-12(15)10-17-18-16(21)8-11-3-2-4-13(19)7-11;9-10-8(12)5-6-2-1-3-7(11)4-6;1-11-8-4-7(10)3-2-6(8)5-9/h2-7,9-10,19-20H,8H2,1H3,(H,18,21);1-4,11H,5,9H2,(H,10,12);2-5,10H,1H3 |
| InChIKey | IIUJXCUHVYZBTA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 213.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.64 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|