C26H32N2O2 — CID 15871174
(2E,4E)-5-(2,3-dicyclohexylquinoxalin-6-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 15871174) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is (2E,4E)-5-(2,3-dicyclohexylquinoxalin-6-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-(2,3-dicyclohexylquinoxalin-6-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 15871174 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | (2E,4E)-5-(2,3-dicyclohexylquinoxalin-6-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/c1ccc2nc(C3CCCCC3)c(C3CCCCC3)nc2c1)=C\C(=O)O |
| InChI | InChI=1S/C26H32N2O2/c1-18(16-24(29)30)12-13-19-14-15-22-23(17-19)28-26(21-10-6-3-7-11-21)25(27-22)20-8-4-2-5-9-20/h12-17,20-21H,2-11H2,1H3,(H,29,30)/b13-12+,18-16+ |
| InChIKey | YHINWWOREZAPKB-SMSZEUIGSA-N |
| XLogP | 6.77 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|