C28H18F3N2O5+ — CID 59926035
(E)-3-[4-[3-[4-[(E)-2-carboxyethenyl]phenyl]-4-(2,2,2-trifluoroacetyl)quinoxalin-4-ium-2-yl]phenyl]prop-2-enoic acid (PubChem CID 59926035) has the molecular formula C28H18F3N2O5+ and a molecular weight of 519.46 g/mol. Its IUPAC name is (E)-3-[4-[3-[4-[(E)-2-carboxyethenyl]phenyl]-4-(2,2,2-trifluoroacetyl)quinoxalin-4-ium-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-[4-[(E)-2-carboxyethenyl]phenyl]-4-(2,2,2-trifluoroacetyl)quinoxalin-4-ium-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59926035 |
| Molecular Formula | C28H18F3N2O5+ |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | (E)-3-[4-[3-[4-[(E)-2-carboxyethenyl]phenyl]-4-(2,2,2-trifluoroacetyl)quinoxalin-4-ium-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2nc3ccccc3[n+](C(=O)C(F)(F)F)c2-c2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H17F3N2O5/c29-28(30,31)27(38)33-22-4-2-1-3-21(22)32-25(19-11-5-17(6-12-19)9-15-23(34)35)26(33)20-13-7-18(8-14-20)10-16-24(36)37/h1-16H,(H-,34,35,36,37)/p+1/b15-9+,16-10+ |
| InChIKey | AZIRXFSUBSWLFL-KAVGSWPWSA-O |
| XLogP | 5.25 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|