C26H20N2O4 — CID 21334828
(E)-3-[4-[3-[4-[(E)-3,3-dihydroxyprop-1-enyl]phenyl]quinoxalin-2-yl]phenyl]prop-2-enoic acid (PubChem CID 21334828) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is (E)-3-[4-[3-[4-[(E)-3,3-dihydroxyprop-1-enyl]phenyl]quinoxalin-2-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[3-[4-[(E)-3,3-dihydroxyprop-1-enyl]phenyl]quinoxalin-2-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 21334828 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (E)-3-[4-[3-[4-[(E)-3,3-dihydroxyprop-1-enyl]phenyl]quinoxalin-2-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(-c2nc3ccccc3nc2-c2ccc(/C=C/C(O)O)cc2)cc1 |
| InChI | InChI=1S/C26H20N2O4/c29-23(30)15-9-17-5-11-19(12-6-17)25-26(28-22-4-2-1-3-21(22)27-25)20-13-7-18(8-14-20)10-16-24(31)32/h1-16,23,29-30H,(H,31,32)/b15-9+,16-10+ |
| InChIKey | NTLQJAMNIDRUBC-KAVGSWPWSA-N |
| XLogP | 4.39 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|