About dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum
dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum (PubChem CID 72794534) has the molecular formula C20H20N2O4Pt
and a molecular weight of 547.47 g/mol. Its IUPAC name is dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum.
Molecular Properties
| Compound Name | dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum |
| PubChem CID | 72794534 |
| Molecular Formula | C20H20N2O4Pt |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum |
| SMILES | COC(=O)C=CC(=O)OC.Cc1ccc2ccc3ccc(C)nc3c2n1.[Pt] |
| InChI | InChI=1S/C14H12N2.C6H8O4.Pt/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;1-9-5(7)3-4-6(8)10-2;/h3-8H,1-2H3;3-4H,1-2H3; |
| InChIKey | OUWUWMIDQDZYQD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum?
The IUPAC name of dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum (CID 72794534) is dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum.
What is the SMILES notation for dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum?
The canonical SMILES for dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum is COC(=O)C=CC(=O)OC.Cc1ccc2ccc3ccc(C)nc3c2n1.[Pt].
What is the InChIKey of dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum?
The InChIKey is OUWUWMIDQDZYQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2.C6H8O4.Pt/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;1-9-5(7)3-4-6(8)10-2;/h3-8H,1-2H3;3-4H,1-2H3;.
What are the key properties of dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum?
dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum has a molecular weight of 547.47 g/mol, XLogP of 3.29, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum is sourced from PubChem (CID 72794534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).