C20H20N2O4Pt — CID 72794534
dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum (PubChem CID 72794534) has the molecular formula C20H20N2O4Pt and a molecular weight of 547.47 g/mol. Its IUPAC name is dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum.
| Compound Name | dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum |
|---|---|
| PubChem CID | 72794534 |
| Molecular Formula | C20H20N2O4Pt |
| Molecular Weight | 547.47 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | dimethyl but-2-enedioate;2,9-dimethyl-1,10-phenanthroline;platinum |
| SMILES | COC(=O)C=CC(=O)OC.Cc1ccc2ccc3ccc(C)nc3c2n1.[Pt] |
| InChI | InChI=1S/C14H12N2.C6H8O4.Pt/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;1-9-5(7)3-4-6(8)10-2;/h3-8H,1-2H3;3-4H,1-2H3; |
| InChIKey | OUWUWMIDQDZYQD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|