C22H26N2O2 — CID 15871170
(2E,4E)-3-methyl-5-(6,6,9,9-tetramethyl-7,8-dihydrophenazin-2-yl)penta-2,4-dienoic acid (PubChem CID 15871170) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is (2E,4E)-3-methyl-5-(6,6,9,9-tetramethyl-7,8-dihydrophenazin-2-yl)penta-2,4-dienoic acid.
| Compound Name | (2E,4E)-3-methyl-5-(6,6,9,9-tetramethyl-7,8-dihydrophenazin-2-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 15871170 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (2E,4E)-3-methyl-5-(6,6,9,9-tetramethyl-7,8-dihydrophenazin-2-yl)penta-2,4-dienoic acid |
| SMILES | CC(/C=C/c1ccc2nc3c(nc2c1)C(C)(C)CCC3(C)C)=C\C(=O)O |
| InChI | InChI=1S/C22H26N2O2/c1-14(12-18(25)26)6-7-15-8-9-16-17(13-15)24-20-19(23-16)21(2,3)10-11-22(20,4)5/h6-9,12-13H,10-11H2,1-5H3,(H,25,26)/b7-6+,14-12+ |
| InChIKey | NIXIMLCQUOAVEW-CKRYPDTRSA-N |
| XLogP | 5.02 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|