C25H28N4O — CID 15871399
1-(3,5-dimethylpiperidin-1-yl)-2-[(2,6-diphenylpyrimidin-4-yl)amino]ethanone (PubChem CID 15871399) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperidin-1-yl)-2-[(2,6-diphenylpyrimidin-4-yl)amino]ethanone.
| Compound Name | 1-(3,5-dimethylpiperidin-1-yl)-2-[(2,6-diphenylpyrimidin-4-yl)amino]ethanone |
|---|---|
| PubChem CID | 15871399 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-(3,5-dimethylpiperidin-1-yl)-2-[(2,6-diphenylpyrimidin-4-yl)amino]ethanone |
| SMILES | CC1CC(C)CN(C(=O)CNc2cc(-c3ccccc3)nc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C25H28N4O/c1-18-13-19(2)17-29(16-18)24(30)15-26-23-14-22(20-9-5-3-6-10-20)27-25(28-23)21-11-7-4-8-12-21/h3-12,14,18-19H,13,15-17H2,1-2H3,(H,26,27,28) |
| InChIKey | YWWMCGHOLYEOMQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |