C26H36N2O3 — CID 158714004
methyl 1-(1-cyclooctylpiperidin-4-yl)-2-methylidene-4-oxo-5H-1-benzazepine-8-carboxylate (PubChem CID 158714004) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is methyl 1-(1-cyclooctylpiperidin-4-yl)-2-methylidene-4-oxo-5H-1-benzazepine-8-carboxylate.
| Compound Name | methyl 1-(1-cyclooctylpiperidin-4-yl)-2-methylidene-4-oxo-5H-1-benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 158714004 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | methyl 1-(1-cyclooctylpiperidin-4-yl)-2-methylidene-4-oxo-5H-1-benzazepine-8-carboxylate |
| SMILES | C=C1CC(=O)Cc2ccc(C(=O)OC)cc2N1C1CCN(C2CCCCCCC2)CC1 |
| InChI | InChI=1S/C26H36N2O3/c1-19-16-24(29)17-20-10-11-21(26(30)31-2)18-25(20)28(19)23-12-14-27(15-13-23)22-8-6-4-3-5-7-9-22/h10-11,18,22-23H,1,3-9,12-17H2,2H3 |
| InChIKey | HSDWZIOJJTYJJB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |