C22H33N3O10 — CID 158715651
N-[2-(diethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid (PubChem CID 158715651) has the molecular formula C22H33N3O10 and a molecular weight of 499.52 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid.
| Compound Name | N-[2-(diethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 158715651 |
| Molecular Formula | C22H33N3O10 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid |
| SMILES | CCN(CC)CCNC(=O)N1CCC(Oc2cccc(C)c2)C1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H29N3O2.2C2H2O4/c1-4-20(5-2)12-10-19-18(22)21-11-9-17(14-21)23-16-8-6-7-15(3)13-16;2*3-1(4)2(5)6/h6-8,13,17H,4-5,9-12,14H2,1-3H3,(H,19,22);2*(H,3,4)(H,5,6) |
| InChIKey | IJGTXVYOGUHGJJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 194.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|