C18H27N3O6 — CID 159475474
N-[2-(dimethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid (PubChem CID 159475474) has the molecular formula C18H27N3O6 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 159475474 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-(3-methylphenoxy)pyrrolidine-1-carboxamide;oxalic acid |
| SMILES | Cc1cccc(OC2CCN(C(=O)NCCN(C)C)C2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H25N3O2.C2H2O4/c1-13-5-4-6-14(11-13)21-15-7-9-19(12-15)16(20)17-8-10-18(2)3;3-1(4)2(5)6/h4-6,11,15H,7-10,12H2,1-3H3,(H,17,20);(H,3,4)(H,5,6) |
| InChIKey | NJDBVYIBXCNRGF-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 119.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|