C74H112BKN11O12PS — CID 158717110
CID 158717110 (PubChem CID 158717110) has the molecular formula C74H112BKN11O12PS and a molecular weight of 1460.73 g/mol.
| Compound Name | CID 158717110 |
|---|---|
| PubChem CID | 158717110 |
| Molecular Formula | C74H112BKN11O12PS |
| Molecular Weight | 1460.73 g/mol |
| Exact Mass | 1459.77 |
| IUPAC Name | — |
| SMILES | CCCCC[C@@H](CC(=O)[C@H](CCCCN)NC(=O)[C@@H](CC(=O)[C@H](CCSC)NC(=O)[C@@H](CC(=O)[C@@H](NC(=O)[C@@H](CC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCCN=C(N)N)CC(=O)[C@H](N)CCCCN)Cc1ccc(O)cc1)C(C)C)C(C)C)Cc1c[nH]c2ccccc12)C(=O)O.[B][PH-].[K+] |
| InChI | InChI=1S/C74H111N11O12S.BHP.K/c1-7-8-10-22-51(73(96)97)41-64(88)60(27-16-18-34-76)82-70(93)53(39-54-45-81-59-26-14-13-24-56(54)59)43-65(89)61(32-36-98-6)83-72(95)57(46(2)3)44-67(91)68(47(4)5)85-71(94)52(37-49-28-30-55(86)31-29-49)42-66(90)62(38-48-20-11-9-12-21-48)84-69(92)50(23-19-35-80-74(78)79)40-63(87)58(77)25-15-17-33-75;1-2;/h9,11-14,20-21,24,26,28-31,45-47,50-53,57-58,60-62,68,81,86H,7-8,10,15-19,22-23,25,27,32-44,75-77H2,1-6H3,(H,82,93)(H,83,95)(H,84,92)(H,85,94)(H,96,97)(H4,78,79,80);2H;/q;-1;+1/t50-,51+,52-,53-,57+,58-,60+,61+,62+,68+;;/m1../s1 |
| InChIKey | WQXLXEARHISHJQ-GAEBDRPPSA-N |
| XLogP | 4.30 |
| TPSA | 417.53 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 101 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1460.73 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|