C29H66O9Si5 — CID 158717181
8-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl]propoxy]ethoxy]octanal (PubChem CID 158717181) has the molecular formula C29H66O9Si5 and a molecular weight of 699.27 g/mol. Its IUPAC name is 8-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl]propoxy]ethoxy]octanal.
| Compound Name | 8-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl]propoxy]ethoxy]octanal |
|---|---|
| PubChem CID | 158717181 |
| Molecular Formula | C29H66O9Si5 |
| Molecular Weight | 699.27 g/mol |
| Exact Mass | 698.36 |
| IUPAC Name | 8-[2-[3-[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl]propoxy]ethoxy]octanal |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCOCCOCCCCCCCC=O)O[Si](C)(CCCOCC1CO1)O[Si](C)(C)C |
| InChI | InChI=1S/C29H66O9Si5/c1-39(2,3)35-41(7,8)37-43(10,26-17-21-32-24-23-31-20-16-14-12-11-13-15-19-30)38-42(9,36-40(4,5)6)25-18-22-33-27-29-28-34-29/h19,29H,11-18,20-28H2,1-10H3 |
| InChIKey | GLGFCNCJHAJNMT-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 94.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.27 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|