C19H38O3Si — CID 177269497
2-[(2S,3R)-3-[(1S)-1-tri(propan-2-yl)silyloxyhexyl]oxiran-2-yl]acetaldehyde (PubChem CID 177269497) has the molecular formula C19H38O3Si and a molecular weight of 342.60 g/mol. Its IUPAC name is 2-[(2S,3R)-3-[(1S)-1-tri(propan-2-yl)silyloxyhexyl]oxiran-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,3R)-3-[(1S)-1-tri(propan-2-yl)silyloxyhexyl]oxiran-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 177269497 |
| Molecular Formula | C19H38O3Si |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 2-[(2S,3R)-3-[(1S)-1-tri(propan-2-yl)silyloxyhexyl]oxiran-2-yl]acetaldehyde |
| SMILES | CCCCC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1O[C@H]1CC=O |
| InChI | InChI=1S/C19H38O3Si/c1-8-9-10-11-18(19-17(21-19)12-13-20)22-23(14(2)3,15(4)5)16(6)7/h13-19H,8-12H2,1-7H3/t17-,18-,19+/m0/s1 |
| InChIKey | OGBDKTPGSHQKKY-GBESFXJTSA-N |
| XLogP | 5.48 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|