C12H24O3Si — CID 102012218
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3S)-3-methyloxiran-2-yl]propanal (PubChem CID 102012218) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3S)-3-methyloxiran-2-yl]propanal.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3S)-3-methyloxiran-2-yl]propanal |
|---|---|
| PubChem CID | 102012218 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3S)-3-methyloxiran-2-yl]propanal |
| SMILES | C[C@@H]1O[C@H]1[C@H](CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-9-11(14-9)10(7-8-13)15-16(5,6)12(2,3)4/h8-11H,7H2,1-6H3/t9-,10-,11+/m0/s1 |
| InChIKey | SCMQIVOQNYIDIH-GARJFASQSA-N |
| XLogP | 2.75 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|