C39H63NO7S — CID 158718244
1-[(1R,2S)-3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-propylnon-8-ene-1,4,5-trione (PubChem CID 158718244) has the molecular formula C39H63NO7S and a molecular weight of 690.00 g/mol. Its IUPAC name is 1-[(1R,2S)-3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-propylnon-8-ene-1,4,5-trione.
| Compound Name | 1-[(1R,2S)-3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-propylnon-8-ene-1,4,5-trione |
|---|---|
| PubChem CID | 158718244 |
| Molecular Formula | C39H63NO7S |
| Molecular Weight | 690.00 g/mol |
| Exact Mass | 689.43 |
| IUPAC Name | 1-[(1R,2S)-3-[(2S)-2-tert-butyl-5-[1-(tert-butylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-propylnon-8-ene-1,4,5-trione |
| SMILES | C=CCCC(=O)C(=O)C(CCC)CC(=O)[C@@H]1[C@@H]2C(CN1C(=O)[C@@H](CC(=O)CC1(CS(=O)(=O)C(C)(C)C)CCCCC1)C(C)(C)C)C2(C)C |
| InChI | InChI=1S/C39H63NO7S/c1-11-13-18-30(42)34(44)26(17-12-2)21-31(43)33-32-29(38(32,9)10)24-40(33)35(45)28(36(3,4)5)22-27(41)23-39(19-15-14-16-20-39)25-48(46,47)37(6,7)8/h11,26,28-29,32-33H,1,12-25H2,2-10H3/t26?,28-,29?,32+,33-/m1/s1 |
| InChIKey | OVDWHGRRBRFWBL-TVZGZZPLSA-N |
| XLogP | 7.12 |
| TPSA | 122.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.00 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|