C32H48F2N2O6 — CID 21017404
tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-(4,5-dioxo-3-propylnon-8-enoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate (PubChem CID 21017404) has the molecular formula C32H48F2N2O6 and a molecular weight of 594.74 g/mol. Its IUPAC name is tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-(4,5-dioxo-3-propylnon-8-enoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-(4,5-dioxo-3-propylnon-8-enoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 21017404 |
| Molecular Formula | C32H48F2N2O6 |
| Molecular Weight | 594.74 g/mol |
| Exact Mass | 594.35 |
| IUPAC Name | tert-butyl N-[1-(4,4-difluorocyclohexyl)-2-[2-(4,5-dioxo-3-propylnon-8-enoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-2-oxoethyl]carbamate |
| SMILES | C=CCCC(=O)C(=O)C(CCC)CC(=O)C1C2C(CN1C(=O)C(NC(=O)OC(C)(C)C)C1CCC(F)(F)CC1)C2(C)C |
| InChI | InChI=1S/C32H48F2N2O6/c1-8-10-12-22(37)27(39)20(11-9-2)17-23(38)26-24-21(31(24,6)7)18-36(26)28(40)25(35-29(41)42-30(3,4)5)19-13-15-32(33,34)16-14-19/h8,19-21,24-26H,1,9-18H2,2-7H3,(H,35,41) |
| InChIKey | VYXVYBLFIBJEKG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.74 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|