C39H56N2O8S — CID 58263046
tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-(8-benzylsulfonyl-3-but-3-enyl-4,5-dioxooctanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58263046) has the molecular formula C39H56N2O8S and a molecular weight of 712.95 g/mol. Its IUPAC name is tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-(8-benzylsulfonyl-3-but-3-enyl-4,5-dioxooctanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-(8-benzylsulfonyl-3-but-3-enyl-4,5-dioxooctanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58263046 |
| Molecular Formula | C39H56N2O8S |
| Molecular Weight | 712.95 g/mol |
| Exact Mass | 712.38 |
| IUPAC Name | tert-butyl N-[(1S)-2-[(1R,2S,5S)-2-(8-benzylsulfonyl-3-but-3-enyl-4,5-dioxooctanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-3-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | C=CCCC(CC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCCC1)C2(C)C)C(=O)C(=O)CCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C39H56N2O8S/c1-7-8-18-28(35(44)30(42)21-15-22-50(47,48)25-26-16-11-9-12-17-26)23-31(43)34-32-29(39(32,5)6)24-41(34)36(45)33(27-19-13-10-14-20-27)40-37(46)49-38(2,3)4/h7,9,11-12,16-17,27-29,32-34H,1,8,10,13-15,18-25H2,2-6H3,(H,40,46)/t28?,29-,32-,33-,34+/m0/s1 |
| InChIKey | LKFYKULJSQJMKT-GBUYXCQOSA-N |
| XLogP | 6.02 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.95 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|