C17H32O5 — CID 158722308
(4-ethyl-4-methyloxolan-2-yl)methanol;methyl 4-ethyl-4-methyloxolane-2-carboxylate (PubChem CID 158722308) has the molecular formula C17H32O5 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4-ethyl-4-methyloxolan-2-yl)methanol;methyl 4-ethyl-4-methyloxolane-2-carboxylate.
| Compound Name | (4-ethyl-4-methyloxolan-2-yl)methanol;methyl 4-ethyl-4-methyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 158722308 |
| Molecular Formula | C17H32O5 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | (4-ethyl-4-methyloxolan-2-yl)methanol;methyl 4-ethyl-4-methyloxolane-2-carboxylate |
| SMILES | CCC1(C)COC(C(=O)OC)C1.CCC1(C)COC(CO)C1 |
| InChI | InChI=1S/C9H16O3.C8H16O2/c1-4-9(2)5-7(12-6-9)8(10)11-3;1-3-8(2)4-7(5-9)10-6-8/h7H,4-6H2,1-3H3;7,9H,3-6H2,1-2H3 |
| InChIKey | IKBKEJUYHNMEND-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |