C44H84O8 — CID 158723826
1-hydroxybutan-2-yl (Z)-18-hydroxyoctadec-9-enoate;1-hydroxybutan-2-yl (E)-18-hydroxyoctadec-9-enoate (PubChem CID 158723826) has the molecular formula C44H84O8 and a molecular weight of 741.15 g/mol. Its IUPAC name is 1-hydroxybutan-2-yl (Z)-18-hydroxyoctadec-9-enoate;1-hydroxybutan-2-yl (E)-18-hydroxyoctadec-9-enoate.
| Compound Name | 1-hydroxybutan-2-yl (Z)-18-hydroxyoctadec-9-enoate;1-hydroxybutan-2-yl (E)-18-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 158723826 |
| Molecular Formula | C44H84O8 |
| Molecular Weight | 741.15 g/mol |
| Exact Mass | 740.62 |
| IUPAC Name | 1-hydroxybutan-2-yl (Z)-18-hydroxyoctadec-9-enoate;1-hydroxybutan-2-yl (E)-18-hydroxyoctadec-9-enoate |
| SMILES | CCC(CO)OC(=O)CCCCCCC/C=C/CCCCCCCCO.CCC(CO)OC(=O)CCCCCCC/C=C\CCCCCCCCO |
| InChI | InChI=1S/2C22H42O4/c2*1-2-21(20-24)26-22(25)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-23/h2*3-4,21,23-24H,2,5-20H2,1H3/b4-3+;4-3- |
| InChIKey | IKGBGCLBEXEJLT-YXTPZADFSA-N |
| XLogP | 10.62 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.15 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|