About 2-bromoethyl prop-2-enyl carbonate
2-bromoethyl prop-2-enyl carbonate (PubChem CID 158726189) has the molecular formula C6H9BrO3
and a molecular weight of 209.04 g/mol. Its IUPAC name is 2-bromoethyl prop-2-enyl carbonate.
Molecular Properties
| Compound Name | 2-bromoethyl prop-2-enyl carbonate |
| PubChem CID | 158726189 |
| Molecular Formula | C6H9BrO3 |
| Molecular Weight | 209.04 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | 2-bromoethyl prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)OCCBr |
| InChI | InChI=1S/C6H9BrO3/c1-2-4-9-6(8)10-5-3-7/h2H,1,3-5H2 |
| InChIKey | LJZIUWWTWIISGE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.04 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl prop-2-enyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl prop-2-enyl carbonate?
The IUPAC name of 2-bromoethyl prop-2-enyl carbonate (CID 158726189) is 2-bromoethyl prop-2-enyl carbonate.
What is the SMILES notation for 2-bromoethyl prop-2-enyl carbonate?
The canonical SMILES for 2-bromoethyl prop-2-enyl carbonate is C=CCOC(=O)OCCBr.
What is the InChIKey of 2-bromoethyl prop-2-enyl carbonate?
The InChIKey is LJZIUWWTWIISGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9BrO3/c1-2-4-9-6(8)10-5-3-7/h2H,1,3-5H2.
What are the key properties of 2-bromoethyl prop-2-enyl carbonate?
2-bromoethyl prop-2-enyl carbonate has a molecular weight of 209.04 g/mol, XLogP of 1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl prop-2-enyl carbonate is sourced from PubChem (CID 158726189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).