About ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane
ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane (PubChem CID 158727156) has the molecular formula C5H11O6P2-3
and a molecular weight of 229.08 g/mol. Its IUPAC name is ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane.
Molecular Properties
| Compound Name | ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane |
| PubChem CID | 158727156 |
| Molecular Formula | C5H11O6P2-3 |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane |
| SMILES | C.C=CP(=O)([O-])O.C=CP(=O)([O-])[O-] |
| InChI | InChI=1S/2C2H5O3P.CH4/c2*1-2-6(3,4)5;/h2*2H,1H2,(H2,3,4,5);1H4/p-3 |
| InChIKey | IKQMYJGCIBFCJJ-UHFFFAOYSA-K |
| XLogP | -0.64 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane?
The IUPAC name of ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane (CID 158727156) is ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane.
What is the SMILES notation for ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane?
The canonical SMILES for ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane is C.C=CP(=O)([O-])O.C=CP(=O)([O-])[O-].
What is the InChIKey of ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane?
The InChIKey is IKQMYJGCIBFCJJ-UHFFFAOYSA-K. The full InChI is InChI=1S/2C2H5O3P.CH4/c2*1-2-6(3,4)5;/h2*2H,1H2,(H2,3,4,5);1H4/p-3.
What are the key properties of ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane?
ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane has a molecular weight of 229.08 g/mol, XLogP of -0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-dioxido-oxo-λ5-phosphane;ethenyl(hydroxy)phosphinate;methane is sourced from PubChem (CID 158727156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).