About decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol
decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 158728123) has the molecular formula C16H38N2O3
and a molecular weight of 306.49 g/mol. Its IUPAC name is decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol.
Molecular Properties
| Compound Name | decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol |
| PubChem CID | 158728123 |
| Molecular Formula | C16H38N2O3 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.CCCCCCCCCCNN |
| InChI | InChI=1S/C10H24N2.C6H14O3/c1-2-3-4-5-6-7-8-9-10-12-11;1-5(8)4-9-6(2)3-7/h12H,2-11H2,1H3;5-8H,3-4H2,1-2H3 |
| InChIKey | IKTMEMVWNBLKAG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
The IUPAC name of decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol (CID 158728123) is decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol.
What is the SMILES notation for decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
The canonical SMILES for decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol is CC(O)COC(C)CO.CCCCCCCCCCNN.
What is the InChIKey of decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
The InChIKey is IKTMEMVWNBLKAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2.C6H14O3/c1-2-3-4-5-6-7-8-9-10-12-11;1-5(8)4-9-6(2)3-7/h12H,2-11H2,1H3;5-8H,3-4H2,1-2H3.
What are the key properties of decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol?
decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol has a molecular weight of 306.49 g/mol, XLogP of 2.36, 13 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for decylhydrazine;2-(2-hydroxypropoxy)propan-1-ol is sourced from PubChem (CID 158728123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).