About acetaldehyde;acetic acid;ethyl acetate
acetaldehyde;acetic acid;ethyl acetate (PubChem CID 158728597) has the molecular formula C8H16O5
and a molecular weight of 192.21 g/mol. Its IUPAC name is acetaldehyde;acetic acid;ethyl acetate.
Molecular Properties
| Compound Name | acetaldehyde;acetic acid;ethyl acetate |
| PubChem CID | 158728597 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | acetaldehyde;acetic acid;ethyl acetate |
| SMILES | CC(=O)O.CC=O.CCOC(C)=O |
| InChI | InChI=1S/C4H8O2.C2H4O2.C2H4O/c1-3-6-4(2)5;1-2(3)4;1-2-3/h3H2,1-2H3;1H3,(H,3,4);2H,1H3 |
| InChIKey | QOQSWWWCVZXRNE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;acetic acid;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;acetic acid;ethyl acetate?
The IUPAC name of acetaldehyde;acetic acid;ethyl acetate (CID 158728597) is acetaldehyde;acetic acid;ethyl acetate.
What is the SMILES notation for acetaldehyde;acetic acid;ethyl acetate?
The canonical SMILES for acetaldehyde;acetic acid;ethyl acetate is CC(=O)O.CC=O.CCOC(C)=O.
What is the InChIKey of acetaldehyde;acetic acid;ethyl acetate?
The InChIKey is QOQSWWWCVZXRNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.C2H4O2.C2H4O/c1-3-6-4(2)5;1-2(3)4;1-2-3/h3H2,1-2H3;1H3,(H,3,4);2H,1H3.
What are the key properties of acetaldehyde;acetic acid;ethyl acetate?
acetaldehyde;acetic acid;ethyl acetate has a molecular weight of 192.21 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;acetic acid;ethyl acetate is sourced from PubChem (CID 158728597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).