C19H20N3+ — CID 158734463
2-(1,3-dimethylimidazol-1-ium-4-yl)-3,9-dimethylcarbazole (PubChem CID 158734463) has the molecular formula C19H20N3+ and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(1,3-dimethylimidazol-1-ium-4-yl)-3,9-dimethylcarbazole.
| Compound Name | 2-(1,3-dimethylimidazol-1-ium-4-yl)-3,9-dimethylcarbazole |
|---|---|
| PubChem CID | 158734463 |
| Molecular Formula | C19H20N3+ |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-(1,3-dimethylimidazol-1-ium-4-yl)-3,9-dimethylcarbazole |
| SMILES | Cc1cc2c3ccccc3n(C)c2cc1-c1c[n+](C)cn1C |
| InChI | InChI=1S/C19H20N3/c1-13-9-16-14-7-5-6-8-17(14)22(4)18(16)10-15(13)19-11-20(2)12-21(19)3/h5-12H,1-4H3/q+1 |
| InChIKey | ULVRAHNXVSPPGA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 13.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|