C31H50N2O6S — CID 158738874
ethyl 3-benzylsulfanyl-2-formamido-3-methyloctanoate;ethyl (E)-2-formamido-3-methyloct-2-enoate (PubChem CID 158738874) has the molecular formula C31H50N2O6S and a molecular weight of 578.82 g/mol. Its IUPAC name is ethyl 3-benzylsulfanyl-2-formamido-3-methyloctanoate;ethyl (E)-2-formamido-3-methyloct-2-enoate.
| Compound Name | ethyl 3-benzylsulfanyl-2-formamido-3-methyloctanoate;ethyl (E)-2-formamido-3-methyloct-2-enoate |
|---|---|
| PubChem CID | 158738874 |
| Molecular Formula | C31H50N2O6S |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | ethyl 3-benzylsulfanyl-2-formamido-3-methyloctanoate;ethyl (E)-2-formamido-3-methyloct-2-enoate |
| SMILES | CCCCC/C(C)=C(/NC=O)C(=O)OCC.CCCCCC(C)(SCc1ccccc1)C(NC=O)C(=O)OCC |
| InChI | InChI=1S/C19H29NO3S.C12H21NO3/c1-4-6-10-13-19(3,17(20-15-21)18(22)23-5-2)24-14-16-11-8-7-9-12-16;1-4-6-7-8-10(3)11(13-9-14)12(15)16-5-2/h7-9,11-12,15,17H,4-6,10,13-14H2,1-3H3,(H,20,21);9H,4-8H2,1-3H3,(H,13,14)/b;11-10+ |
| InChIKey | IMAKSYZCXJZKPK-AZQMUMGESA-N |
| XLogP | 6.09 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|