C23H29BrO2S2 — CID 57287657
ethyl 5,5-bis(benzylsulfanyl)-2-bromo-4,4-dimethylpentanoate (PubChem CID 57287657) has the molecular formula C23H29BrO2S2 and a molecular weight of 481.52 g/mol. Its IUPAC name is ethyl 5,5-bis(benzylsulfanyl)-2-bromo-4,4-dimethylpentanoate.
| Compound Name | ethyl 5,5-bis(benzylsulfanyl)-2-bromo-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 57287657 |
| Molecular Formula | C23H29BrO2S2 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | ethyl 5,5-bis(benzylsulfanyl)-2-bromo-4,4-dimethylpentanoate |
| SMILES | CCOC(=O)C(Br)CC(C)(C)C(SCc1ccccc1)SCc1ccccc1 |
| InChI | InChI=1S/C23H29BrO2S2/c1-4-26-21(25)20(24)15-23(2,3)22(27-16-18-11-7-5-8-12-18)28-17-19-13-9-6-10-14-19/h5-14,20,22H,4,15-17H2,1-3H3 |
| InChIKey | VDBBQPHBQJUWIT-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|