C34H54O14 — CID 158739668
5-O-[2-[5-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropoxy]-5-oxopentanoyl]oxyethyl] 1-O-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropyl] pentanedioate (PubChem CID 158739668) has the molecular formula C34H54O14 and a molecular weight of 686.79 g/mol. Its IUPAC name is 5-O-[2-[5-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropoxy]-5-oxopentanoyl]oxyethyl] 1-O-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropyl] pentanedioate.
| Compound Name | 5-O-[2-[5-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropoxy]-5-oxopentanoyl]oxyethyl] 1-O-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropyl] pentanedioate |
|---|---|
| PubChem CID | 158739668 |
| Molecular Formula | C34H54O14 |
| Molecular Weight | 686.79 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | 5-O-[2-[5-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropoxy]-5-oxopentanoyl]oxyethyl] 1-O-[3-(5,5-dimethyl-4-oxohexanoyl)oxypropyl] pentanedioate |
| SMILES | CC(C)(C)C(=O)CCC(=O)OCCCOC(=O)CCCC(=O)OCCOC(=O)CCCC(=O)OCCCOC(=O)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H54O14/c1-33(2,3)25(35)15-17-31(41)45-21-9-19-43-27(37)11-7-13-29(39)47-23-24-48-30(40)14-8-12-28(38)44-20-10-22-46-32(42)18-16-26(36)34(4,5)6/h7-24H2,1-6H3 |
| InChIKey | VSCHRUNIQRWUII-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.79 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|