C32H30BClN6O6 — CID 158752252
2-chloro-3-nitropyridine;5-(3-nitro-2-pyridinyl)-1H-indole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 158752252) has the molecular formula C32H30BClN6O6 and a molecular weight of 640.89 g/mol. Its IUPAC name is 2-chloro-3-nitropyridine;5-(3-nitro-2-pyridinyl)-1H-indole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 2-chloro-3-nitropyridine;5-(3-nitro-2-pyridinyl)-1H-indole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 158752252 |
| Molecular Formula | C32H30BClN6O6 |
| Molecular Weight | 640.89 g/mol |
| Exact Mass | 640.20 |
| IUPAC Name | 2-chloro-3-nitropyridine;5-(3-nitro-2-pyridinyl)-1H-indole;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | CC1(C)OB(c2ccc3[nH]ccc3c2)OC1(C)C.O=[N+]([O-])c1cccnc1-c1ccc2[nH]ccc2c1.O=[N+]([O-])c1cccnc1Cl |
| InChI | InChI=1S/C14H18BNO2.C13H9N3O2.C5H3ClN2O2/c1-13(2)14(3,4)18-15(17-13)11-5-6-12-10(9-11)7-8-16-12;17-16(18)12-2-1-6-15-13(12)10-3-4-11-9(8-10)5-7-14-11;6-5-4(8(9)10)2-1-3-7-5/h5-9,16H,1-4H3;1-8,14H;1-3H |
| InChIKey | INPZEPGYIVRUBO-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 162.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.89 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|