C34H32BClN4O6 — CID 159997583
2-chloro-3-nitropyridine;2-(3H-inden-5-yl)-3-nitropyridine;2-(3H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 159997583) has the molecular formula C34H32BClN4O6 and a molecular weight of 638.92 g/mol. Its IUPAC name is 2-chloro-3-nitropyridine;2-(3H-inden-5-yl)-3-nitropyridine;2-(3H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-chloro-3-nitropyridine;2-(3H-inden-5-yl)-3-nitropyridine;2-(3H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 159997583 |
| Molecular Formula | C34H32BClN4O6 |
| Molecular Weight | 638.92 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | 2-chloro-3-nitropyridine;2-(3H-inden-5-yl)-3-nitropyridine;2-(3H-inden-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc3c(c2)CC=C3)OC1(C)C.O=[N+]([O-])c1cccnc1-c1ccc2c(c1)CC=C2.O=[N+]([O-])c1cccnc1Cl |
| InChI | InChI=1S/C15H19BO2.C14H10N2O2.C5H3ClN2O2/c1-14(2)15(3,4)18-16(17-14)13-9-8-11-6-5-7-12(11)10-13;17-16(18)13-5-2-8-15-14(13)12-7-6-10-3-1-4-11(10)9-12;6-5-4(8(9)10)2-1-3-7-5/h5-6,8-10H,7H2,1-4H3;1-3,5-9H,4H2;1-3H |
| InChIKey | OHSYAMSKOBCKCK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 130.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.92 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|