About 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine
2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine (PubChem CID 159298158) has the molecular formula C17H13ClN4O4
and a molecular weight of 372.77 g/mol. Its IUPAC name is 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine.
Molecular Properties
| Compound Name | 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine |
| PubChem CID | 159298158 |
| Molecular Formula | C17H13ClN4O4 |
| Molecular Weight | 372.77 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine |
| SMILES | Cc1ccc(-c2ncccc2[N+](=O)[O-])cc1.O=[N+]([O-])c1cccnc1Cl |
| InChI | InChI=1S/C12H10N2O2.C5H3ClN2O2/c1-9-4-6-10(7-5-9)12-11(14(15)16)3-2-8-13-12;6-5-4(8(9)10)2-1-3-7-5/h2-8H,1H3;1-3H |
| InChIKey | LAZKQGRDGXDCLY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.77 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine?
The IUPAC name of 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine (CID 159298158) is 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine.
What is the SMILES notation for 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine?
The canonical SMILES for 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine is Cc1ccc(-c2ncccc2[N+](=O)[O-])cc1.O=[N+]([O-])c1cccnc1Cl.
What is the InChIKey of 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine?
The InChIKey is LAZKQGRDGXDCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2.C5H3ClN2O2/c1-9-4-6-10(7-5-9)12-11(14(15)16)3-2-8-13-12;6-5-4(8(9)10)2-1-3-7-5/h2-8H,1H3;1-3H.
What are the key properties of 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine?
2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine has a molecular weight of 372.77 g/mol, XLogP of 4.61, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-nitropyridine;2-(4-methylphenyl)-3-nitropyridine is sourced from PubChem (CID 159298158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).