About 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid
2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid (PubChem CID 157102788) has the molecular formula C22H20BClN4O6
and a molecular weight of 482.69 g/mol. Its IUPAC name is 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid.
Molecular Properties
| Compound Name | 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid |
| PubChem CID | 157102788 |
| Molecular Formula | C22H20BClN4O6 |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid |
| SMILES | O=[N+]([O-])c1ccc(Cl)nc1.OB(O)c1ccccc1.[O-][NH+](O)c1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C11H10N2O2.C6H7BO2.C5H3ClN2O2/c14-13(15)10-6-7-11(12-8-10)9-4-2-1-3-5-9;8-7(9)6-4-2-1-3-5-6;6-5-2-1-4(3-7-5)8(9)10/h1-8,13-14H;1-5,8-9H;1-3H |
| InChIKey | AFYMYNQWCVWNRJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 157.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid?
The IUPAC name of 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid (CID 157102788) is 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid.
What is the SMILES notation for 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid?
The canonical SMILES for 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid is O=[N+]([O-])c1ccc(Cl)nc1.OB(O)c1ccccc1.[O-][NH+](O)c1ccc(-c2ccccc2)nc1.
What is the InChIKey of 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid?
The InChIKey is AFYMYNQWCVWNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2.C6H7BO2.C5H3ClN2O2/c14-13(15)10-6-7-11(12-8-10)9-4-2-1-3-5-9;8-7(9)6-4-2-1-3-5-6;6-5-2-1-4(3-7-5)8(9)10/h1-8,13-14H;1-5,8-9H;1-3H.
What are the key properties of 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid?
2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid has a molecular weight of 482.69 g/mol, XLogP of 2.16, 4 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-nitropyridine;N-hydroxy-6-phenylpyridin-3-amine oxide;phenylboronic acid is sourced from PubChem (CID 157102788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).