C20H31N3O2S — CID 158753269
3-[(dimethylamino)methyl]benzenesulfonamide;1-phenylpentan-3-amine (PubChem CID 158753269) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]benzenesulfonamide;1-phenylpentan-3-amine.
| Compound Name | 3-[(dimethylamino)methyl]benzenesulfonamide;1-phenylpentan-3-amine |
|---|---|
| PubChem CID | 158753269 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 3-[(dimethylamino)methyl]benzenesulfonamide;1-phenylpentan-3-amine |
| SMILES | CCC(N)CCc1ccccc1.CN(C)Cc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17N.C9H14N2O2S/c1-2-11(12)9-8-10-6-4-3-5-7-10;1-11(2)7-8-4-3-5-9(6-8)14(10,12)13/h3-7,11H,2,8-9,12H2,1H3;3-6H,7H2,1-2H3,(H2,10,12,13) |
| InChIKey | INTALIOZDNNYQM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |