C17H15NO — CID 158755181
2-cyclopropyl-2-(3-phenoxyphenyl)acetonitrile (PubChem CID 158755181) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-cyclopropyl-2-(3-phenoxyphenyl)acetonitrile.
| Compound Name | 2-cyclopropyl-2-(3-phenoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 158755181 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-cyclopropyl-2-(3-phenoxyphenyl)acetonitrile |
| SMILES | N#CC(c1cccc(Oc2ccccc2)c1)C1CC1 |
| InChI | InChI=1S/C17H15NO/c18-12-17(13-9-10-13)14-5-4-8-16(11-14)19-15-6-2-1-3-7-15/h1-8,11,13,17H,9-10H2 |
| InChIKey | INZBSHWRYCOTEP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |