C6H5F3N2O4 — CID 158761215
1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 158761215) has the molecular formula C6H5F3N2O4 and a molecular weight of 226.11 g/mol. Its IUPAC name is 1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158761215 |
| Molecular Formula | C6H5F3N2O4 |
| Molecular Weight | 226.11 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 1,2-oxazole-3-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1ccon1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C4H4N2O2.C2HF3O2/c5-4(7)3-1-2-8-6-3;3-2(4,5)1(6)7/h1-2H,(H2,5,7);(H,6,7) |
| InChIKey | IORRCTXMIWFSOW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.11 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |