C38H45N9O5 — CID 158762043
N-cyclohexyl-N-methyl-4-pyridin-3-ylimidazole-1-carboxamide;N-methylcyclohexanamine;(4-nitrophenyl) 4-pyridin-3-ylimidazole-1-carboxylate (PubChem CID 158762043) has the molecular formula C38H45N9O5 and a molecular weight of 707.84 g/mol. Its IUPAC name is N-cyclohexyl-N-methyl-4-pyridin-3-ylimidazole-1-carboxamide;N-methylcyclohexanamine;(4-nitrophenyl) 4-pyridin-3-ylimidazole-1-carboxylate.
| Compound Name | N-cyclohexyl-N-methyl-4-pyridin-3-ylimidazole-1-carboxamide;N-methylcyclohexanamine;(4-nitrophenyl) 4-pyridin-3-ylimidazole-1-carboxylate |
|---|---|
| PubChem CID | 158762043 |
| Molecular Formula | C38H45N9O5 |
| Molecular Weight | 707.84 g/mol |
| Exact Mass | 707.35 |
| IUPAC Name | N-cyclohexyl-N-methyl-4-pyridin-3-ylimidazole-1-carboxamide;N-methylcyclohexanamine;(4-nitrophenyl) 4-pyridin-3-ylimidazole-1-carboxylate |
| SMILES | CN(C(=O)n1cnc(-c2cccnc2)c1)C1CCCCC1.CNC1CCCCC1.O=C(Oc1ccc([N+](=O)[O-])cc1)n1cnc(-c2cccnc2)c1 |
| InChI | InChI=1S/C16H20N4O.C15H10N4O4.C7H15N/c1-19(14-7-3-2-4-8-14)16(21)20-11-15(18-12-20)13-6-5-9-17-10-13;20-15(23-13-5-3-12(4-6-13)19(21)22)18-9-14(17-10-18)11-2-1-7-16-8-11;1-8-7-5-3-2-4-6-7/h5-6,9-12,14H,2-4,7-8H2,1H3;1-10H;7-8H,2-6H2,1H3 |
| InChIKey | BDKYBZCRXDAVOB-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 163.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.84 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|