About acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol
acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol (PubChem CID 158762949) has the molecular formula C25H44O6
and a molecular weight of 440.62 g/mol. Its IUPAC name is acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol.
Molecular Properties
| Compound Name | acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol |
| PubChem CID | 158762949 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol |
| SMILES | CC(=O)OC(C)=O.CC1OCCCC12CCCCC2.OC1OCCCC12CCCCC2 |
| InChI | InChI=1S/C11H20O.C10H18O2.C4H6O3/c1-10-11(8-5-9-12-10)6-3-2-4-7-11;11-9-10(7-4-8-12-9)5-2-1-3-6-10;1-3(5)7-4(2)6/h10H,2-9H2,1H3;9,11H,1-8H2;1-2H3 |
| InChIKey | IOWZXPYKUHBYSQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol?
The IUPAC name of acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol (CID 158762949) is acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol.
What is the SMILES notation for acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol?
The canonical SMILES for acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol is CC(=O)OC(C)=O.CC1OCCCC12CCCCC2.OC1OCCCC12CCCCC2.
What is the InChIKey of acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol?
The InChIKey is IOWZXPYKUHBYSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O.C10H18O2.C4H6O3/c1-10-11(8-5-9-12-10)6-3-2-4-7-11;11-9-10(7-4-8-12-9)5-2-1-3-6-10;1-3(5)7-4(2)6/h10H,2-9H2,1H3;9,11H,1-8H2;1-2H3.
What are the key properties of acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol?
acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol has a molecular weight of 440.62 g/mol, XLogP of 5.30, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl acetate;1-methyl-2-oxaspiro[5.5]undecane;2-oxaspiro[5.5]undecan-1-ol is sourced from PubChem (CID 158762949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).