C30H40ClN3O2 — CID 158763409
(3S)-3-[(10R)-5-(4-chlorophenyl)-9-[2-(dimethylamino)ethyl]-2,7,10-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-3-[(2-methylpropan-2-yl)oxy]prop-1-en-2-ol (PubChem CID 158763409) has the molecular formula C30H40ClN3O2 and a molecular weight of 510.12 g/mol. Its IUPAC name is (3S)-3-[(10R)-5-(4-chlorophenyl)-9-[2-(dimethylamino)ethyl]-2,7,10-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-3-[(2-methylpropan-2-yl)oxy]prop-1-en-2-ol.
| Compound Name | (3S)-3-[(10R)-5-(4-chlorophenyl)-9-[2-(dimethylamino)ethyl]-2,7,10-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-3-[(2-methylpropan-2-yl)oxy]prop-1-en-2-ol |
|---|---|
| PubChem CID | 158763409 |
| Molecular Formula | C30H40ClN3O2 |
| Molecular Weight | 510.12 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | (3S)-3-[(10R)-5-(4-chlorophenyl)-9-[2-(dimethylamino)ethyl]-2,7,10-trimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]-3-[(2-methylpropan-2-yl)oxy]prop-1-en-2-ol |
| SMILES | C=C(O)[C@@H](OC(C)(C)C)c1c(C)c2c3c(cc(C)n3C[C@@H](C)N2CCN(C)C)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H40ClN3O2/c1-18-16-24-26(22-10-12-23(31)13-11-22)25(29(21(4)35)36-30(5,6)7)20(3)27-28(24)34(18)17-19(2)33(27)15-14-32(8)9/h10-13,16,19,29,35H,4,14-15,17H2,1-3,5-9H3/t19-,29-/m1/s1 |
| InChIKey | NEVTVSRCVHZBBO-SONOPUAISA-N |
| XLogP | 7.28 |
| TPSA | 40.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.12 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|