C29H39ClN2O2S — CID 145197212
2-[(10R)-5-(4-chlorophenyl)-2,7,10-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2,2-dimethylpropane;ethene (PubChem CID 145197212) has the molecular formula C29H39ClN2O2S and a molecular weight of 515.16 g/mol. Its IUPAC name is 2-[(10R)-5-(4-chlorophenyl)-2,7,10-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2,2-dimethylpropane;ethene.
| Compound Name | 2-[(10R)-5-(4-chlorophenyl)-2,7,10-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2,2-dimethylpropane;ethene |
|---|---|
| PubChem CID | 145197212 |
| Molecular Formula | C29H39ClN2O2S |
| Molecular Weight | 515.16 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 2-[(10R)-5-(4-chlorophenyl)-2,7,10-trimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2,2-dimethylpropane;ethene |
| SMILES | C=C.CC(C)(C)C.CSN1c2c(C)c(CC(=O)O)c(-c3ccc(Cl)cc3)c3cc(C)n(c23)C[C@H]1C |
| InChI | InChI=1S/C22H23ClN2O2S.C5H12.C2H4/c1-12-9-18-20(15-5-7-16(23)8-6-15)17(10-19(26)27)14(3)21-22(18)24(12)11-13(2)25(21)28-4;1-5(2,3)4;1-2/h5-9,13H,10-11H2,1-4H3,(H,26,27);1-4H3;1-2H2/t13-;;/m1../s1 |
| InChIKey | UGVYXONWFQJMAO-FFXKMJQXSA-N |
| XLogP | 8.55 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.16 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|