C30H39ClF2N2OS — CID 145197324
1-[5-(4-chlorophenyl)-10-(difluoromethyl)-2,7-dimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]propan-2-one;2,2-dimethylpropane;ethene (PubChem CID 145197324) has the molecular formula C30H39ClF2N2OS and a molecular weight of 549.17 g/mol. Its IUPAC name is 1-[5-(4-chlorophenyl)-10-(difluoromethyl)-2,7-dimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]propan-2-one;2,2-dimethylpropane;ethene.
| Compound Name | 1-[5-(4-chlorophenyl)-10-(difluoromethyl)-2,7-dimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]propan-2-one;2,2-dimethylpropane;ethene |
|---|---|
| PubChem CID | 145197324 |
| Molecular Formula | C30H39ClF2N2OS |
| Molecular Weight | 549.17 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | 1-[5-(4-chlorophenyl)-10-(difluoromethyl)-2,7-dimethyl-9-methylsulfanyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]propan-2-one;2,2-dimethylpropane;ethene |
| SMILES | C=C.CC(C)(C)C.CSN1c2c(C)c(CC(C)=O)c(-c3ccc(Cl)cc3)c3cc(C)n(c23)CC1C(F)F |
| InChI | InChI=1S/C23H23ClF2N2OS.C5H12.C2H4/c1-12-9-18-20(15-5-7-16(24)8-6-15)17(10-13(2)29)14(3)21-22(18)27(12)11-19(23(25)26)28(21)30-4;1-5(2,3)4;1-2/h5-9,19,23H,10-11H2,1-4H3;1-4H3;1-2H2 |
| InChIKey | ZKWYCFAOSFAUTO-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.17 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|