C27H36ClN3O3 — CID 145197375
N-[[5-(4-chlorophenyl)-6-ethyl-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]methyl]methanimine;formic acid;2-methylpropan-2-ol (PubChem CID 145197375) has the molecular formula C27H36ClN3O3 and a molecular weight of 486.06 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)-6-ethyl-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]methyl]methanimine;formic acid;2-methylpropan-2-ol.
| Compound Name | N-[[5-(4-chlorophenyl)-6-ethyl-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]methyl]methanimine;formic acid;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 145197375 |
| Molecular Formula | C27H36ClN3O3 |
| Molecular Weight | 486.06 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | N-[[5-(4-chlorophenyl)-6-ethyl-2,7-dimethyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]methyl]methanimine;formic acid;2-methylpropan-2-ol |
| SMILES | C=NCN1CCn2c(C)cc3c(-c4ccc(Cl)cc4)c(CC)c(C)c1c32.CC(C)(C)O.O=CO |
| InChI | InChI=1S/C22H24ClN3.C4H10O.CH2O2/c1-5-18-15(3)21-22-19(20(18)16-6-8-17(23)9-7-16)12-14(2)26(22)11-10-25(21)13-24-4;1-4(2,3)5;2-1-3/h6-9,12H,4-5,10-11,13H2,1-3H3;5H,1-3H3;1H,(H,2,3) |
| InChIKey | ZZYRCOOKXMQDQX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.06 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|