C33H43N3O4 — CID 145197569
[6-[6-ethyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]-2-pyridinyl]methanol;methyl formate;2-methylpropan-2-ol (PubChem CID 145197569) has the molecular formula C33H43N3O4 and a molecular weight of 545.72 g/mol. Its IUPAC name is [6-[6-ethyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]-2-pyridinyl]methanol;methyl formate;2-methylpropan-2-ol.
| Compound Name | [6-[6-ethyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]-2-pyridinyl]methanol;methyl formate;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 145197569 |
| Molecular Formula | C33H43N3O4 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | [6-[6-ethyl-2,7-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]-2-pyridinyl]methanol;methyl formate;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CCc1c(C)c2c3c(cc(C)n3CCN2c2cccc(CO)n2)c1-c1ccc(C)cc1.COC=O |
| InChI | InChI=1S/C27H29N3O.C4H10O.C2H4O2/c1-5-22-19(4)26-27-23(25(22)20-11-9-17(2)10-12-20)15-18(3)29(27)13-14-30(26)24-8-6-7-21(16-31)28-24;1-4(2,3)5;1-4-2-3/h6-12,15,31H,5,13-14,16H2,1-4H3;5H,1-3H3;2H,1H3 |
| InChIKey | COVZQBLBHKTCKW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|