C27H32N2O — CID 134407357
1-[2,7-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]butan-1-one (PubChem CID 134407357) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is 1-[2,7-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]butan-1-one.
| Compound Name | 1-[2,7-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]butan-1-one |
|---|---|
| PubChem CID | 134407357 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-[2,7-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-9-yl]butan-1-one |
| SMILES | C=C(C)Cc1c(C)c2c3c(cc(C)n3CCN2C(=O)CCC)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C27H32N2O/c1-7-8-24(30)29-14-13-28-19(5)16-23-25(21-11-9-18(4)10-12-21)22(15-17(2)3)20(6)26(29)27(23)28/h9-12,16H,2,7-8,13-15H2,1,3-6H3 |
| InChIKey | NIADQZHHVNPFHS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|