C26H32N2 — CID 134407595
7,9-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-2-propyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 134407595) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 7,9-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-2-propyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 7,9-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-2-propyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 134407595 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 7,9-dimethyl-5-(4-methylphenyl)-6-(2-methylprop-2-enyl)-2-propyl-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | C=C(C)Cc1c(C)c2c3c(cc(CCC)n3CCN2C)c1-c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32N2/c1-7-8-21-16-23-24(20-11-9-18(4)10-12-20)22(15-17(2)3)19(5)25-26(23)28(21)14-13-27(25)6/h9-12,16H,2,7-8,13-15H2,1,3-6H3 |
| InChIKey | SSGLAMVZLKYPHP-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|