C34H42FN3O4 — CID 144960055
1-(4-fluorophenyl)-N-methylmethanamine;2-[2-formyl-7,9-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol (PubChem CID 144960055) has the molecular formula C34H42FN3O4 and a molecular weight of 575.73 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methylmethanamine;2-[2-formyl-7,9-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol.
| Compound Name | 1-(4-fluorophenyl)-N-methylmethanamine;2-[2-formyl-7,9-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 144960055 |
| Molecular Formula | C34H42FN3O4 |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methylmethanamine;2-[2-formyl-7,9-dimethyl-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CNCc1ccc(F)cc1.Cc1ccc(-c2c(CC(=O)O)c(C)c3c4c2cc(C=O)n4CCN3C)cc1 |
| InChI | InChI=1S/C22H22N2O3.C8H10FN.C4H10O/c1-13-4-6-15(7-5-13)20-17(11-19(26)27)14(2)21-22-18(20)10-16(12-25)24(22)9-8-23(21)3;1-10-6-7-2-4-8(9)5-3-7;1-4(2,3)5/h4-7,10,12H,8-9,11H2,1-3H3,(H,26,27);2-5,10H,6H2,1H3;5H,1-3H3 |
| InChIKey | HIGMABDBMZLGGM-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|