C27H33BN2O4 — CID 145197146
2-[7,9-dimethyl-5-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid (PubChem CID 145197146) has the molecular formula C27H33BN2O4 and a molecular weight of 460.38 g/mol. Its IUPAC name is 2-[7,9-dimethyl-5-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid.
| Compound Name | 2-[7,9-dimethyl-5-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid |
|---|---|
| PubChem CID | 145197146 |
| Molecular Formula | C27H33BN2O4 |
| Molecular Weight | 460.38 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 2-[7,9-dimethyl-5-(4-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid |
| SMILES | Cc1ccc(-c2c(CC(=O)O)c(C)c3c4c2cc(B2OC(C)(C)C(C)(C)O2)n4CCN3C)cc1 |
| InChI | InChI=1S/C27H33BN2O4/c1-16-8-10-18(11-9-16)23-19(15-22(31)32)17(2)24-25-20(23)14-21(30(25)13-12-29(24)7)28-33-26(3,4)27(5,6)34-28/h8-11,14H,12-13,15H2,1-7H3,(H,31,32) |
| InChIKey | PQFWGUFYPGNBEE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|