C27H35N3O3 — CID 145197225
2-[2,7-dimethyl-9-[(methylideneamino)methyl]-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol (PubChem CID 145197225) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-[2,7-dimethyl-9-[(methylideneamino)methyl]-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol.
| Compound Name | 2-[2,7-dimethyl-9-[(methylideneamino)methyl]-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 145197225 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | 2-[2,7-dimethyl-9-[(methylideneamino)methyl]-5-(4-methylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-6-yl]acetic acid;2-methylpropan-2-ol |
| SMILES | C=NCN1CCn2c(C)cc3c(-c4ccc(C)cc4)c(CC(=O)O)c(C)c1c32.CC(C)(C)O |
| InChI | InChI=1S/C23H25N3O2.C4H10O/c1-14-5-7-17(8-6-14)21-18(12-20(27)28)16(3)22-23-19(21)11-15(2)26(23)10-9-25(22)13-24-4;1-4(2,3)5/h5-8,11H,4,9-10,12-13H2,1-3H3,(H,27,28);5H,1-3H3 |
| InChIKey | QSFKSKIIPUJFTG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|