C26H34N2 — CID 134407599
6-ethyl-2,7,9,11,11-pentamethyl-5-(4-propylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene (PubChem CID 134407599) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 6-ethyl-2,7,9,11,11-pentamethyl-5-(4-propylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene.
| Compound Name | 6-ethyl-2,7,9,11,11-pentamethyl-5-(4-propylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
|---|---|
| PubChem CID | 134407599 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 6-ethyl-2,7,9,11,11-pentamethyl-5-(4-propylphenyl)-1,9-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene |
| SMILES | CCCc1ccc(-c2c(CC)c(C)c3c4c2cc(C)n4C(C)(C)CN3C)cc1 |
| InChI | InChI=1S/C26H34N2/c1-8-10-19-11-13-20(14-12-19)23-21(9-2)18(4)24-25-22(23)15-17(3)28(25)26(5,6)16-27(24)7/h11-15H,8-10,16H2,1-7H3 |
| InChIKey | YQOJECMDSABDOT-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |