C13H14ClNO3S — CID 165472179
[5-(4-propylphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (PubChem CID 165472179) has the molecular formula C13H14ClNO3S and a molecular weight of 299.78 g/mol. Its IUPAC name is [5-(4-propylphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride.
| Compound Name | [5-(4-propylphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 165472179 |
| Molecular Formula | C13H14ClNO3S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | [5-(4-propylphenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
| SMILES | CCCc1ccc(-c2cc(CS(=O)(=O)Cl)no2)cc1 |
| InChI | InChI=1S/C13H14ClNO3S/c1-2-3-10-4-6-11(7-5-10)13-8-12(15-18-13)9-19(14,16)17/h4-8H,2-3,9H2,1H3 |
| InChIKey | RSFFHHFVQJPJIZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |