C10H7ClN2O5S — CID 165472182
[5-(4-nitrophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride (PubChem CID 165472182) has the molecular formula C10H7ClN2O5S and a molecular weight of 302.69 g/mol. Its IUPAC name is [5-(4-nitrophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride.
| Compound Name | [5-(4-nitrophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 165472182 |
| Molecular Formula | C10H7ClN2O5S |
| Molecular Weight | 302.69 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | [5-(4-nitrophenyl)-1,2-oxazol-3-yl]methanesulfonyl chloride |
| SMILES | O=[N+]([O-])c1ccc(-c2cc(CS(=O)(=O)Cl)no2)cc1 |
| InChI | InChI=1S/C10H7ClN2O5S/c11-19(16,17)6-8-5-10(18-12-8)7-1-3-9(4-2-7)13(14)15/h1-5H,6H2 |
| InChIKey | BQRKGOXEMCWYIR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 103.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.69 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|